C16H20F2N2O3S — CID 126495986
(5R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 126495986) has the molecular formula C16H20F2N2O3S and a molecular weight of 358.41 g/mol. Its IUPAC name is (5R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 126495986 |
| Molecular Formula | C16H20F2N2O3S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (5R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](CO)CN1c1cc(F)c(N2CCCSCCC2)c(F)c1 |
| InChI | InChI=1S/C16H20F2N2O3S/c17-13-7-11(20-9-12(10-21)23-16(20)22)8-14(18)15(13)19-3-1-5-24-6-2-4-19/h7-8,12,21H,1-6,9-10H2/t12-/m1/s1 |
| InChIKey | WPNXVUZQUIZXKL-GFCCVEGCSA-N |
| XLogP | 2.62 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|