C16H22F2N2O3S — CID 126483830
(2R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-ol (PubChem CID 126483830) has the molecular formula C16H22F2N2O3S and a molecular weight of 360.43 g/mol. Its IUPAC name is (2R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-ol.
| Compound Name | (2R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-ol |
|---|---|
| PubChem CID | 126483830 |
| Molecular Formula | C16H22F2N2O3S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2R)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-ol |
| SMILES | OCC1CN(c2cc(F)c(N3CCCSCCC3)c(F)c2)[C@H](O)O1 |
| InChI | InChI=1S/C16H22F2N2O3S/c17-13-7-11(20-9-12(10-21)23-16(20)22)8-14(18)15(13)19-3-1-5-24-6-2-4-19/h7-8,12,16,21-22H,1-6,9-10H2/t12?,16-/m1/s1 |
| InChIKey | MSGNZERXBZPTTC-PVQCJRHBSA-N |
| XLogP | 1.77 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|