C21H28F2N2O3S — CID 157071806
(5S)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(3-oxohexyl)-1,3-oxazolidin-2-one (PubChem CID 157071806) has the molecular formula C21H28F2N2O3S and a molecular weight of 426.53 g/mol. Its IUPAC name is (5S)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(3-oxohexyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(3-oxohexyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 157071806 |
| Molecular Formula | C21H28F2N2O3S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (5S)-3-[3,5-difluoro-4-(1,5-thiazocan-5-yl)phenyl]-5-(3-oxohexyl)-1,3-oxazolidin-2-one |
| SMILES | CCCC(=O)CC[C@H]1CN(c2cc(F)c(N3CCCSCCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H28F2N2O3S/c1-2-5-16(26)6-7-17-14-25(21(27)28-17)15-12-18(22)20(19(23)13-15)24-8-3-10-29-11-4-9-24/h12-13,17H,2-11,14H2,1H3/t17-/m0/s1 |
| InChIKey | IOXBUPFHULFOPD-KRWDZBQOSA-N |
| XLogP | 4.77 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|