C17H21F2N3O3 — CID 59953051
(5S)-3-[4-(4-acetylpiperazin-1-yl)-3,5-difluorophenyl]-5-ethyl-1,3-oxazolidin-2-one (PubChem CID 59953051) has the molecular formula C17H21F2N3O3 and a molecular weight of 353.37 g/mol. Its IUPAC name is (5S)-3-[4-(4-acetylpiperazin-1-yl)-3,5-difluorophenyl]-5-ethyl-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-(4-acetylpiperazin-1-yl)-3,5-difluorophenyl]-5-ethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59953051 |
| Molecular Formula | C17H21F2N3O3 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (5S)-3-[4-(4-acetylpiperazin-1-yl)-3,5-difluorophenyl]-5-ethyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@H]1CN(c2cc(F)c(N3CCN(C(C)=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H21F2N3O3/c1-3-13-10-22(17(24)25-13)12-8-14(18)16(15(19)9-12)21-6-4-20(5-7-21)11(2)23/h8-9,13H,3-7,10H2,1-2H3/t13-/m0/s1 |
| InChIKey | RJSDGGMTKWMDRO-ZDUSSCGKSA-N |
| XLogP | 2.37 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|