C15H19AcF2N4O2- — CID 22943605
actinium;[3-[3,5-difluoro-4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylazanide (PubChem CID 22943605) has the molecular formula C15H19AcF2N4O2- and a molecular weight of 552.34 g/mol. Its IUPAC name is actinium;[3-[3,5-difluoro-4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylazanide.
| Compound Name | actinium;[3-[3,5-difluoro-4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylazanide |
|---|---|
| PubChem CID | 22943605 |
| Molecular Formula | C15H19AcF2N4O2- |
| Molecular Weight | 552.34 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | actinium;[3-[3,5-difluoro-4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylazanide |
| SMILES | CN1CCN(c2c(F)cc(N3CC(C[NH-])OC3=O)cc2F)CC1.[Ac] |
| InChI | InChI=1S/C15H19F2N4O2.Ac/c1-19-2-4-20(5-3-19)14-12(16)6-10(7-13(14)17)21-9-11(8-18)23-15(21)22;/h6-7,11,18H,2-5,8-9H2,1H3;/q-1; |
| InChIKey | IGCCBVIWSBHUFF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|