C22H29F4N7O5 — CID 76699342
5-[4-[5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(4-methylpiperazin-1-yl)-1,2,5-oxadiazepane-2-carboxamide (PubChem CID 76699342) has the molecular formula C22H29F4N7O5 and a molecular weight of 547.51 g/mol. Its IUPAC name is 5-[4-[5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(4-methylpiperazin-1-yl)-1,2,5-oxadiazepane-2-carboxamide.
| Compound Name | 5-[4-[5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(4-methylpiperazin-1-yl)-1,2,5-oxadiazepane-2-carboxamide |
|---|---|
| PubChem CID | 76699342 |
| Molecular Formula | C22H29F4N7O5 |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 5-[4-[5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(4-methylpiperazin-1-yl)-1,2,5-oxadiazepane-2-carboxamide |
| SMILES | CN1CCN(NC(=O)N2CCN(c3c(F)cc(N4CC(CNC(=O)C(F)F)OC4=O)cc3F)CCO2)CC1 |
| InChI | InChI=1S/C22H29F4N7O5/c1-29-2-5-31(6-3-29)28-21(35)33-7-4-30(8-9-37-33)18-16(23)10-14(11-17(18)24)32-13-15(38-22(32)36)12-27-20(34)19(25)26/h10-11,15,19H,2-9,12-13H2,1H3,(H,27,34)(H,28,35) |
| InChIKey | SMTPLDVVWNLBJQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|