C21H26F2N6O6 — CID 90243663
5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(5-methyl-2,3-dihydro-1,2-oxazol-3-yl)-1,2,5-oxadiazepane-2-carboxamide (PubChem CID 90243663) has the molecular formula C21H26F2N6O6 and a molecular weight of 496.47 g/mol. Its IUPAC name is 5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(5-methyl-2,3-dihydro-1,2-oxazol-3-yl)-1,2,5-oxadiazepane-2-carboxamide.
| Compound Name | 5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(5-methyl-2,3-dihydro-1,2-oxazol-3-yl)-1,2,5-oxadiazepane-2-carboxamide |
|---|---|
| PubChem CID | 90243663 |
| Molecular Formula | C21H26F2N6O6 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(5-methyl-2,3-dihydro-1,2-oxazol-3-yl)-1,2,5-oxadiazepane-2-carboxamide |
| SMILES | CC(=O)NC[C@H]1CN(c2cc(F)c(N3CCON(C(=O)NC4C=C(C)ON4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H26F2N6O6/c1-12-7-18(26-35-12)25-20(31)29-4-3-27(5-6-33-29)19-16(22)8-14(9-17(19)23)28-11-15(34-21(28)32)10-24-13(2)30/h7-9,15,18,26H,3-6,10-11H2,1-2H3,(H,24,30)(H,25,31)/t15-,18?/m0/s1 |
| InChIKey | QMKZSEOOCZGEKO-BUSXIPJBSA-N |
| XLogP | 0.95 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|