C23H22F4N4O5S — CID 59531451
N-[[(5S)-3-[3,5-difluoro-4-[2-(2-hydroxybenzoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide (PubChem CID 59531451) has the molecular formula C23H22F4N4O5S and a molecular weight of 542.51 g/mol. Its IUPAC name is N-[[(5S)-3-[3,5-difluoro-4-[2-(2-hydroxybenzoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide.
| Compound Name | N-[[(5S)-3-[3,5-difluoro-4-[2-(2-hydroxybenzoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
|---|---|
| PubChem CID | 59531451 |
| Molecular Formula | C23H22F4N4O5S |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | N-[[(5S)-3-[3,5-difluoro-4-[2-(2-hydroxybenzoyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
| SMILES | O=C(c1ccccc1O)N1CCN(c2c(F)cc(N3C[C@H](CNC(=S)C(F)F)OC3=O)cc2F)CCO1 |
| InChI | InChI=1S/C23H22F4N4O5S/c24-16-9-13(30-12-14(36-23(30)34)11-28-21(37)20(26)27)10-17(25)19(16)29-5-6-31(35-8-7-29)22(33)15-3-1-2-4-18(15)32/h1-4,9-10,14,20,32H,5-8,11-12H2,(H,28,37)/t14-/m0/s1 |
| InChIKey | QGHYYXMMOCFJBN-AWEZNQCLSA-N |
| XLogP | 3.07 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|