C16H15F4N3O3S — CID 87961951
N-[[(5S)-3-[3,5-difluoro-4-(6-oxa-3-azabicyclo[3.1.0]hexan-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide (PubChem CID 87961951) has the molecular formula C16H15F4N3O3S and a molecular weight of 405.37 g/mol. Its IUPAC name is N-[[(5S)-3-[3,5-difluoro-4-(6-oxa-3-azabicyclo[3.1.0]hexan-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide.
| Compound Name | N-[[(5S)-3-[3,5-difluoro-4-(6-oxa-3-azabicyclo[3.1.0]hexan-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
|---|---|
| PubChem CID | 87961951 |
| Molecular Formula | C16H15F4N3O3S |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-[[(5S)-3-[3,5-difluoro-4-(6-oxa-3-azabicyclo[3.1.0]hexan-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
| SMILES | O=C1O[C@@H](CNC(=S)C(F)F)CN1c1cc(F)c(N2CC3OC3C2)c(F)c1 |
| InChI | InChI=1S/C16H15F4N3O3S/c17-9-1-7(2-10(18)13(9)22-5-11-12(6-22)26-11)23-4-8(25-16(23)24)3-21-15(27)14(19)20/h1-2,8,11-12,14H,3-6H2,(H,21,27)/t8-,11?,12?/m0/s1 |
| InChIKey | FNSSRADJQXNTAX-RKWZHAFESA-N |
| XLogP | 2.06 |
| TPSA | 57.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|