C16H21F2N3O4S2 — CID 10320008
N-[[(5S)-3-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide (PubChem CID 10320008) has the molecular formula C16H21F2N3O4S2 and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[[(5S)-3-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide.
| Compound Name | N-[[(5S)-3-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
|---|---|
| PubChem CID | 10320008 |
| Molecular Formula | C16H21F2N3O4S2 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[[(5S)-3-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
| SMILES | O=C1O[C@@H](CNC(=S)C(F)F)CN1c1ccc(N2CCS(O)(O)CC2)cc1 |
| InChI | InChI=1S/C16H21F2N3O4S2/c17-14(18)15(26)19-9-13-10-21(16(22)25-13)12-3-1-11(2-4-12)20-5-7-27(23,24)8-6-20/h1-4,13-14,23-24H,5-10H2,(H,19,26)/t13-/m0/s1 |
| InChIKey | KZMSUWQBHRKUOM-ZDUSSCGKSA-N |
| XLogP | 2.76 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|