C17H21F2N3O3S2 — CID 87973402
2,2-difluoro-N-[[(5S)-3-[4-(1-imino-1-oxothian-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 87973402) has the molecular formula C17H21F2N3O3S2 and a molecular weight of 417.50 g/mol. Its IUPAC name is 2,2-difluoro-N-[[(5S)-3-[4-(1-imino-1-oxothian-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | 2,2-difluoro-N-[[(5S)-3-[4-(1-imino-1-oxothian-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 87973402 |
| Molecular Formula | C17H21F2N3O3S2 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2,2-difluoro-N-[[(5S)-3-[4-(1-imino-1-oxothian-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | [H]N=S1(=O)CCC(c2ccc(N3C[C@H](CNC(=S)C(F)F)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H21F2N3O3S2/c18-15(19)16(26)21-9-14-10-22(17(23)25-14)13-3-1-11(2-4-13)12-5-7-27(20,24)8-6-12/h1-4,12,14-15,20H,5-10H2,(H,21,26)/t12?,14-,27?/m0/s1 |
| InChIKey | KMCZAAZKYKSJNS-URBUVZMZSA-N |
| XLogP | 3.12 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|