C21H27N3O7 — CID 57214552
[2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperidin-1-yl]-1-hydroxy-2-oxoethyl] acetate (PubChem CID 57214552) has the molecular formula C21H27N3O7 and a molecular weight of 433.46 g/mol. Its IUPAC name is [2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperidin-1-yl]-1-hydroxy-2-oxoethyl] acetate.
| Compound Name | [2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperidin-1-yl]-1-hydroxy-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 57214552 |
| Molecular Formula | C21H27N3O7 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperidin-1-yl]-1-hydroxy-2-oxoethyl] acetate |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(C3CCN(C(=O)C(O)OC(C)=O)CC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C21H27N3O7/c1-13(25)22-11-18-12-24(21(29)31-18)17-5-3-15(4-6-17)16-7-9-23(10-8-16)19(27)20(28)30-14(2)26/h3-6,16,18,20,28H,7-12H2,1-2H3,(H,22,25)/t18-,20?/m0/s1 |
| InChIKey | XXGMIAZZDYBZAS-LROBGIAVSA-N |
| XLogP | 0.74 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|