C17H20N4O3 — CID 88572518
N-[[(5S)-3-[4-(1-cyanopyrrolidin-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 88572518) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[[(5S)-3-[4-(1-cyanopyrrolidin-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-(1-cyanopyrrolidin-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 88572518 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-[[(5S)-3-[4-(1-cyanopyrrolidin-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(C3CCN(C#N)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C17H20N4O3/c1-12(22)19-8-16-10-21(17(23)24-16)15-4-2-13(3-5-15)14-6-7-20(9-14)11-18/h2-5,14,16H,6-10H2,1H3,(H,19,22)/t14?,16-/m0/s1 |
| InChIKey | KLVVFDDICMMDCC-WMCAAGNKSA-N |
| XLogP | 1.42 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|