C16H15F4N3O4S2 — CID 20777111
N-[[3-[4-(1,1-dioxo-2,3-dihydro-1,4-thiazin-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide (PubChem CID 20777111) has the molecular formula C16H15F4N3O4S2 and a molecular weight of 453.44 g/mol. Its IUPAC name is N-[[3-[4-(1,1-dioxo-2,3-dihydro-1,4-thiazin-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide.
| Compound Name | N-[[3-[4-(1,1-dioxo-2,3-dihydro-1,4-thiazin-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
|---|---|
| PubChem CID | 20777111 |
| Molecular Formula | C16H15F4N3O4S2 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | N-[[3-[4-(1,1-dioxo-2,3-dihydro-1,4-thiazin-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroethanethioamide |
| SMILES | O=C1OC(CNC(=S)C(F)F)CN1c1cc(F)c(N2C=CS(=O)(=O)CC2)c(F)c1 |
| InChI | InChI=1S/C16H15F4N3O4S2/c17-11-5-9(6-12(18)13(11)22-1-3-29(25,26)4-2-22)23-8-10(27-16(23)24)7-21-15(28)14(19)20/h1,3,5-6,10,14H,2,4,7-8H2,(H,21,28) |
| InChIKey | XWRYATIDECDFNQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|