C20H27N5O4S2 — CID 18619342
N-[[3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide (PubChem CID 18619342) has the molecular formula C20H27N5O4S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[[3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide.
| Compound Name | N-[[3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 18619342 |
| Molecular Formula | C20H27N5O4S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[[3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide |
| SMILES | CC(C)C(=S)NCC1CN(c2ccc(N3CCN(S(=O)(=O)CC#N)CC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C20H27N5O4S2/c1-15(2)19(30)22-13-18-14-25(20(26)29-18)17-5-3-16(4-6-17)23-8-10-24(11-9-23)31(27,28)12-7-21/h3-6,15,18H,8-14H2,1-2H3,(H,22,30) |
| InChIKey | ZLGYTOJXVIQXJD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|