C22H27N5O2S — CID 142669217
[(5S)-3-[4-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea (PubChem CID 142669217) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is [(5S)-3-[4-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea.
| Compound Name | [(5S)-3-[4-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
|---|---|
| PubChem CID | 142669217 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [(5S)-3-[4-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
| SMILES | Cc1ccccc1N1CCN(c2ccc(N3C[C@H](CNC(N)=S)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C22H27N5O2S/c1-16-4-2-3-5-20(16)26-12-10-25(11-13-26)17-6-8-18(9-7-17)27-15-19(29-22(27)28)14-24-21(23)30/h2-9,19H,10-15H2,1H3,(H3,23,24,30)/t19-/m0/s1 |
| InChIKey | PRDPNRSXGDUALX-IBGZPJMESA-N |
| XLogP | 2.48 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|