C16H16N4O2S — CID 85054920
[2-oxo-3-(4-pyridin-4-ylphenyl)-1,3-oxazolidin-5-yl]methylthiourea (PubChem CID 85054920) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is [2-oxo-3-(4-pyridin-4-ylphenyl)-1,3-oxazolidin-5-yl]methylthiourea.
| Compound Name | [2-oxo-3-(4-pyridin-4-ylphenyl)-1,3-oxazolidin-5-yl]methylthiourea |
|---|---|
| PubChem CID | 85054920 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [2-oxo-3-(4-pyridin-4-ylphenyl)-1,3-oxazolidin-5-yl]methylthiourea |
| SMILES | NC(=S)NCC1CN(c2ccc(-c3ccncc3)cc2)C(=O)O1 |
| InChI | InChI=1S/C16H16N4O2S/c17-15(23)19-9-14-10-20(16(21)22-14)13-3-1-11(2-4-13)12-5-7-18-8-6-12/h1-8,14H,9-10H2,(H3,17,19,23) |
| InChIKey | OBRNGIHZWMXEQJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|