C14H15FN4O4S — CID 21026244
[3-[3-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea (PubChem CID 21026244) has the molecular formula C14H15FN4O4S and a molecular weight of 354.36 g/mol. Its IUPAC name is [3-[3-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea.
| Compound Name | [3-[3-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
|---|---|
| PubChem CID | 21026244 |
| Molecular Formula | C14H15FN4O4S |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [3-[3-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
| SMILES | NC(=S)NCC1CN(c2ccc(N3CCOC3=O)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C14H15FN4O4S/c15-10-5-8(1-2-11(10)18-3-4-22-13(18)20)19-7-9(23-14(19)21)6-17-12(16)24/h1-2,5,9H,3-4,6-7H2,(H3,16,17,24) |
| InChIKey | ZZRWOLMHUDDETH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|