C11H12FN3O2S — CID 141073578
[(5S)-3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methylthiourea (PubChem CID 141073578) has the molecular formula C11H12FN3O2S and a molecular weight of 269.30 g/mol. Its IUPAC name is [(5S)-3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methylthiourea.
| Compound Name | [(5S)-3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
|---|---|
| PubChem CID | 141073578 |
| Molecular Formula | C11H12FN3O2S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | [(5S)-3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
| SMILES | NC(=S)NC[C@H]1CN(c2cccc(F)c2)C(=O)O1 |
| InChI | InChI=1S/C11H12FN3O2S/c12-7-2-1-3-8(4-7)15-6-9(17-11(15)16)5-14-10(13)18/h1-4,9H,5-6H2,(H3,13,14,18)/t9-/m0/s1 |
| InChIKey | JJXCGJQAWOELRM-VIFPVBQESA-N |
| XLogP | 0.98 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|