C15H15FN4O2S — CID 20616657
[3-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea (PubChem CID 20616657) has the molecular formula C15H15FN4O2S and a molecular weight of 334.38 g/mol. Its IUPAC name is [3-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea.
| Compound Name | [3-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
|---|---|
| PubChem CID | 20616657 |
| Molecular Formula | C15H15FN4O2S |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [3-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
| SMILES | [C-]#[N+]C1(c2ccc(N3CC(CNC(N)=S)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C15H15FN4O2S/c1-18-15(4-5-15)11-3-2-9(6-12(11)16)20-8-10(22-14(20)21)7-19-13(17)23/h2-3,6,10H,4-5,7-8H2,(H3,17,19,23) |
| InChIKey | JFTKMKHAINVYAP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|