C17H25FN4O3S — CID 139799526
[(5S)-3-[4-[4-(dimethylamino)butoxy]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea (PubChem CID 139799526) has the molecular formula C17H25FN4O3S and a molecular weight of 384.48 g/mol. Its IUPAC name is [(5S)-3-[4-[4-(dimethylamino)butoxy]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea.
| Compound Name | [(5S)-3-[4-[4-(dimethylamino)butoxy]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
|---|---|
| PubChem CID | 139799526 |
| Molecular Formula | C17H25FN4O3S |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(5S)-3-[4-[4-(dimethylamino)butoxy]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
| SMILES | CN(C)CCCCOc1ccc(N2C[C@H](CNC(N)=S)OC2=O)cc1F |
| InChI | InChI=1S/C17H25FN4O3S/c1-21(2)7-3-4-8-24-15-6-5-12(9-14(15)18)22-11-13(25-17(22)23)10-20-16(19)26/h5-6,9,13H,3-4,7-8,10-11H2,1-2H3,(H3,19,20,26)/t13-/m0/s1 |
| InChIKey | SCUYFYRVYQFKSX-ZDUSSCGKSA-N |
| XLogP | 1.70 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|