C20H28FN5O4S — CID 139799588
ethyl 3-[4-[4-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]propanoate (PubChem CID 139799588) has the molecular formula C20H28FN5O4S and a molecular weight of 453.54 g/mol. Its IUPAC name is ethyl 3-[4-[4-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]propanoate.
| Compound Name | ethyl 3-[4-[4-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 139799588 |
| Molecular Formula | C20H28FN5O4S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | ethyl 3-[4-[4-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCN(c2ccc(N3C[C@H](CNC(N)=S)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H28FN5O4S/c1-2-29-18(27)5-6-24-7-9-25(10-8-24)17-4-3-14(11-16(17)21)26-13-15(30-20(26)28)12-23-19(22)31/h3-4,11,15H,2,5-10,12-13H2,1H3,(H3,22,23,31)/t15-/m0/s1 |
| InChIKey | XVCFGLIZASLQSC-HNNXBMFYSA-N |
| XLogP | 1.06 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|