C18H25FN4O2S — CID 10762343
[(5S)-3-[4-(4-ethylpiperidin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea (PubChem CID 10762343) has the molecular formula C18H25FN4O2S and a molecular weight of 380.49 g/mol. Its IUPAC name is [(5S)-3-[4-(4-ethylpiperidin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea.
| Compound Name | [(5S)-3-[4-(4-ethylpiperidin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
|---|---|
| PubChem CID | 10762343 |
| Molecular Formula | C18H25FN4O2S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [(5S)-3-[4-(4-ethylpiperidin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
| SMILES | CCC1CCN(c2ccc(N3C[C@H](CNC(N)=S)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C18H25FN4O2S/c1-2-12-5-7-22(8-6-12)16-4-3-13(9-15(16)19)23-11-14(25-18(23)24)10-21-17(20)26/h3-4,9,12,14H,2,5-8,10-11H2,1H3,(H3,20,21,26)/t14-/m0/s1 |
| InChIKey | DIXLNBUYKPZIDV-AWEZNQCLSA-N |
| XLogP | 2.61 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|