C20H27FN4O4S — CID 22140974
ethyl 4-[2-fluoro-4-[2-oxo-5-[(propanethioylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate (PubChem CID 22140974) has the molecular formula C20H27FN4O4S and a molecular weight of 438.53 g/mol. Its IUPAC name is ethyl 4-[2-fluoro-4-[2-oxo-5-[(propanethioylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-fluoro-4-[2-oxo-5-[(propanethioylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22140974 |
| Molecular Formula | C20H27FN4O4S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | ethyl 4-[2-fluoro-4-[2-oxo-5-[(propanethioylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccc(N3CC(CNC(=S)CC)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H27FN4O4S/c1-3-18(30)22-12-15-13-25(20(27)29-15)14-5-6-17(16(21)11-14)23-7-9-24(10-8-23)19(26)28-4-2/h5-6,11,15H,3-4,7-10,12-13H2,1-2H3,(H,22,30) |
| InChIKey | LJVSMJDVKXLZJP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|