C20H28FN5O4S2 — CID 18619355
N-[[3-[4-[4-(dimethylsulfamoyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarbothioamide (PubChem CID 18619355) has the molecular formula C20H28FN5O4S2 and a molecular weight of 485.61 g/mol. Its IUPAC name is N-[[3-[4-[4-(dimethylsulfamoyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarbothioamide.
| Compound Name | N-[[3-[4-[4-(dimethylsulfamoyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarbothioamide |
|---|---|
| PubChem CID | 18619355 |
| Molecular Formula | C20H28FN5O4S2 |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[[3-[4-[4-(dimethylsulfamoyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarbothioamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(c2ccc(N3CC(CNC(=S)C4CC4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H28FN5O4S2/c1-23(2)32(28,29)25-9-7-24(8-10-25)18-6-5-15(11-17(18)21)26-13-16(30-20(26)27)12-22-19(31)14-3-4-14/h5-6,11,14,16H,3-4,7-10,12-13H2,1-2H3,(H,22,31) |
| InChIKey | XEARIMCDDGUBND-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|