C20H28FN5O4S2 — CID 18619467
2-cyclobutyl-N-[[3-[3-fluoro-4-(4-sulfamoylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 18619467) has the molecular formula C20H28FN5O4S2 and a molecular weight of 485.61 g/mol. Its IUPAC name is 2-cyclobutyl-N-[[3-[3-fluoro-4-(4-sulfamoylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | 2-cyclobutyl-N-[[3-[3-fluoro-4-(4-sulfamoylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 18619467 |
| Molecular Formula | C20H28FN5O4S2 |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 2-cyclobutyl-N-[[3-[3-fluoro-4-(4-sulfamoylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | NS(=O)(=O)N1CCN(c2ccc(N3CC(CNC(=S)CC4CCC4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H28FN5O4S2/c21-17-11-15(4-5-18(17)24-6-8-25(9-7-24)32(22,28)29)26-13-16(30-20(26)27)12-23-19(31)10-14-2-1-3-14/h4-5,11,14,16H,1-3,6-10,12-13H2,(H,23,31)(H2,22,28,29) |
| InChIKey | MKHBDCKHAHKRCA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|