C23H31FN4O4S — CID 22943569
N-[[(5S)-3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclohexanecarbothioamide (PubChem CID 22943569) has the molecular formula C23H31FN4O4S and a molecular weight of 478.59 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclohexanecarbothioamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclohexanecarbothioamide |
|---|---|
| PubChem CID | 22943569 |
| Molecular Formula | C23H31FN4O4S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclohexanecarbothioamide |
| SMILES | O=C(CO)N1CCN(c2ccc(N3C[C@H](CNC(=S)C4CCCCC4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C23H31FN4O4S/c24-19-12-17(6-7-20(19)26-8-10-27(11-9-26)21(30)15-29)28-14-18(32-23(28)31)13-25-22(33)16-4-2-1-3-5-16/h6-7,12,16,18,29H,1-5,8-11,13-15H2,(H,25,33)/t18-/m0/s1 |
| InChIKey | OZVNXBUBFIGNBE-SFHVURJKSA-N |
| XLogP | 2.29 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|