C18H22FN5O5S2 — CID 18713323
O-methyl N-[[(5S)-3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 18713323) has the molecular formula C18H22FN5O5S2 and a molecular weight of 471.54 g/mol. Its IUPAC name is O-methyl N-[[(5S)-3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[(5S)-3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 18713323 |
| Molecular Formula | C18H22FN5O5S2 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | O-methyl N-[[(5S)-3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | COC(=S)NC[C@H]1CN(c2ccc(N3CCN(S(=O)(=O)CC#N)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H22FN5O5S2/c1-28-17(30)21-11-14-12-24(18(25)29-14)13-2-3-16(15(19)10-13)22-5-7-23(8-6-22)31(26,27)9-4-20/h2-3,10,14H,5-9,11-12H2,1H3,(H,21,30)/t14-/m0/s1 |
| InChIKey | AORQHKJNGXDUMN-AWEZNQCLSA-N |
| XLogP | 0.65 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|