C18H22FN5O6S — CID 86585623
N-[[(5S)-3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-1-oxoethanamine oxide (PubChem CID 86585623) has the molecular formula C18H22FN5O6S and a molecular weight of 455.47 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-1-oxoethanamine oxide.
| Compound Name | N-[[(5S)-3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-1-oxoethanamine oxide |
|---|---|
| PubChem CID | 86585623 |
| Molecular Formula | C18H22FN5O6S |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[[(5S)-3-[4-[4-(cyanomethylsulfonyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-1-oxoethanamine oxide |
| SMILES | CC(=O)[NH+]([O-])C[C@@H]1CN(c2ccc(N3CCN(S(=O)(=O)CC#N)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H22FN5O6S/c1-13(25)24(27)12-15-11-23(18(26)30-15)14-2-3-17(16(19)10-14)21-5-7-22(8-6-21)31(28,29)9-4-20/h2-3,10,15,24H,5-9,11-12H2,1H3/t15-/m0/s1 |
| InChIKey | WFTJVBBCRHDVEV-HNNXBMFYSA-N |
| XLogP | -0.94 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|