C16H19FN4O2 — CID 91016605
(5S)-5-ethyl-3-[3-fluoro-4-(4-isocyanopiperazin-1-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 91016605) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is (5S)-5-ethyl-3-[3-fluoro-4-(4-isocyanopiperazin-1-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-ethyl-3-[3-fluoro-4-(4-isocyanopiperazin-1-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 91016605 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (5S)-5-ethyl-3-[3-fluoro-4-(4-isocyanopiperazin-1-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | [C-]#[N+]N1CCN(c2ccc(N3C[C@H](CC)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C16H19FN4O2/c1-3-13-11-21(16(22)23-13)12-4-5-15(14(17)10-12)19-6-8-20(18-2)9-7-19/h4-5,10,13H,3,6-9,11H2,1H3/t13-/m0/s1 |
| InChIKey | MISQKUHOLNNFMQ-ZDUSSCGKSA-N |
| XLogP | 2.52 |
| TPSA | 40.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|