C17H19FN4O3 — CID 91333572
3-[4-[2-fluoro-4-(5-methyl-2-oxo-1,3-oxazolidin-3-yl)phenyl]piperazin-1-yl]-3-oxopropanenitrile (PubChem CID 91333572) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is 3-[4-[2-fluoro-4-(5-methyl-2-oxo-1,3-oxazolidin-3-yl)phenyl]piperazin-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[4-[2-fluoro-4-(5-methyl-2-oxo-1,3-oxazolidin-3-yl)phenyl]piperazin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 91333572 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-[4-[2-fluoro-4-(5-methyl-2-oxo-1,3-oxazolidin-3-yl)phenyl]piperazin-1-yl]-3-oxopropanenitrile |
| SMILES | CC1CN(c2ccc(N3CCN(C(=O)CC#N)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H19FN4O3/c1-12-11-22(17(24)25-12)13-2-3-15(14(18)10-13)20-6-8-21(9-7-20)16(23)4-5-19/h2-3,10,12H,4,6-9,11H2,1H3 |
| InChIKey | PYCPFJFWUCUVQW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|