C21H28FN7O4S — CID 91574803
tert-butyl N-azido-N-[2-[4-[2-fluoro-4-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-sulfanylideneethyl]carbamate (PubChem CID 91574803) has the molecular formula C21H28FN7O4S and a molecular weight of 493.57 g/mol. Its IUPAC name is tert-butyl N-azido-N-[2-[4-[2-fluoro-4-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-sulfanylideneethyl]carbamate.
| Compound Name | tert-butyl N-azido-N-[2-[4-[2-fluoro-4-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-sulfanylideneethyl]carbamate |
|---|---|
| PubChem CID | 91574803 |
| Molecular Formula | C21H28FN7O4S |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | tert-butyl N-azido-N-[2-[4-[2-fluoro-4-[(5S)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-sulfanylideneethyl]carbamate |
| SMILES | C[C@H]1CN(c2ccc(N3CCN(C(=S)CN(N=[N+]=[N-])C(=O)OC(C)(C)C)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H28FN7O4S/c1-14-12-28(19(30)32-14)15-5-6-17(16(22)11-15)26-7-9-27(10-8-26)18(34)13-29(25-24-23)20(31)33-21(2,3)4/h5-6,11,14H,7-10,12-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | RBBMHCYDHWNSKZ-AWEZNQCLSA-N |
| XLogP | 4.08 |
| TPSA | 114.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|