C19H27FN2O3Si — CID 158399329
(5S)-3-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)-3-fluorophenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 158399329) has the molecular formula C19H27FN2O3Si and a molecular weight of 378.52 g/mol. Its IUPAC name is (5S)-3-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)-3-fluorophenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)-3-fluorophenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 158399329 |
| Molecular Formula | C19H27FN2O3Si |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (5S)-3-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)-3-fluorophenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CC[C@H]1CN(c2ccc(N3CC[Si](C)(C)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H27FN2O3Si/c1-14(23)4-6-16-13-22(19(24)25-16)15-5-7-18(17(20)12-15)21-8-10-26(2,3)11-9-21/h5,7,12,16H,4,6,8-11,13H2,1-3H3/t16-/m0/s1 |
| InChIKey | GXXGCCREZVDFGJ-INIZCTEOSA-N |
| XLogP | 4.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|