C20H26FN3O6 — CID 157386542
methyl 2-[5-[2-fluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]-1,2,5-oxadiazepan-2-yl]acetate (PubChem CID 157386542) has the molecular formula C20H26FN3O6 and a molecular weight of 423.44 g/mol. Its IUPAC name is methyl 2-[5-[2-fluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]-1,2,5-oxadiazepan-2-yl]acetate.
| Compound Name | methyl 2-[5-[2-fluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]-1,2,5-oxadiazepan-2-yl]acetate |
|---|---|
| PubChem CID | 157386542 |
| Molecular Formula | C20H26FN3O6 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | methyl 2-[5-[2-fluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]-1,2,5-oxadiazepan-2-yl]acetate |
| SMILES | COC(=O)CN1CCN(c2ccc(N3C[C@H](CCC(C)=O)OC3=O)cc2F)CCO1 |
| InChI | InChI=1S/C20H26FN3O6/c1-14(25)3-5-16-12-24(20(27)30-16)15-4-6-18(17(21)11-15)22-7-8-23(29-10-9-22)13-19(26)28-2/h4,6,11,16H,3,5,7-10,12-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | BLMRMZTVBUORFV-INIZCTEOSA-N |
| XLogP | 1.75 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|