C18H21FN4O2 — CID 69315436
2-[1-[4-[5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperidin-4-ylidene]propanenitrile (PubChem CID 69315436) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[1-[4-[5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperidin-4-ylidene]propanenitrile.
| Compound Name | 2-[1-[4-[5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperidin-4-ylidene]propanenitrile |
|---|---|
| PubChem CID | 69315436 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[1-[4-[5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperidin-4-ylidene]propanenitrile |
| SMILES | CC(C#N)=C1CCN(c2ccc(N3CC(CN)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C18H21FN4O2/c1-12(9-20)13-4-6-22(7-5-13)17-3-2-14(8-16(17)19)23-11-15(10-21)25-18(23)24/h2-3,8,15H,4-7,10-11,21H2,1H3 |
| InChIKey | PDJWYWPTAJLNRK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|