C23H29FN4O4 — CID 69313036
[1-[3-[4-[4-(1-cyanoethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-3-methylbutan-2-yl]carbamic acid (PubChem CID 69313036) has the molecular formula C23H29FN4O4 and a molecular weight of 444.51 g/mol. Its IUPAC name is [1-[3-[4-[4-(1-cyanoethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-3-methylbutan-2-yl]carbamic acid.
| Compound Name | [1-[3-[4-[4-(1-cyanoethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-3-methylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69313036 |
| Molecular Formula | C23H29FN4O4 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | [1-[3-[4-[4-(1-cyanoethylidene)piperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-3-methylbutan-2-yl]carbamic acid |
| SMILES | CC(C#N)=C1CCN(c2ccc(N3CC(CC(NC(=O)O)C(C)C)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C23H29FN4O4/c1-14(2)20(26-22(29)30)11-18-13-28(23(31)32-18)17-4-5-21(19(24)10-17)27-8-6-16(7-9-27)15(3)12-25/h4-5,10,14,18,20,26H,6-9,11,13H2,1-3H3,(H,29,30) |
| InChIKey | FSLPXGBAWSYSKS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|