C19H27N5O4S2 — CID 22140955
N-[[3-[4-[4-(methylsulfamoyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarbothioamide (PubChem CID 22140955) has the molecular formula C19H27N5O4S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[[3-[4-[4-(methylsulfamoyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarbothioamide.
| Compound Name | N-[[3-[4-[4-(methylsulfamoyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarbothioamide |
|---|---|
| PubChem CID | 22140955 |
| Molecular Formula | C19H27N5O4S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[[3-[4-[4-(methylsulfamoyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarbothioamide |
| SMILES | CNS(=O)(=O)N1CCN(c2ccc(N3CC(CNC(=S)C4CC4)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C19H27N5O4S2/c1-20-30(26,27)23-10-8-22(9-11-23)15-4-6-16(7-5-15)24-13-17(28-19(24)25)12-21-18(29)14-2-3-14/h4-7,14,17,20H,2-3,8-13H2,1H3,(H,21,29) |
| InChIKey | VNZRSUQXCKIYEX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|