C19H27FN4O2S — CID 22624115
N-[[3-[4-[4-(2-fluoroethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide (PubChem CID 22624115) has the molecular formula C19H27FN4O2S and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[[3-[4-[4-(2-fluoroethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide.
| Compound Name | N-[[3-[4-[4-(2-fluoroethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide |
|---|---|
| PubChem CID | 22624115 |
| Molecular Formula | C19H27FN4O2S |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[[3-[4-[4-(2-fluoroethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide |
| SMILES | CCC(=S)NCC1CN(c2ccc(N3CCN(CCF)CC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C19H27FN4O2S/c1-2-18(27)21-13-17-14-24(19(25)26-17)16-5-3-15(4-6-16)23-11-9-22(8-7-20)10-12-23/h3-6,17H,2,7-14H2,1H3,(H,21,27) |
| InChIKey | SIODFYFJYJLASP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|