C19H26F2N4O4S2 — CID 22140975
N-[[3-[4-(4-ethylsulfonylpiperazin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide (PubChem CID 22140975) has the molecular formula C19H26F2N4O4S2 and a molecular weight of 476.57 g/mol. Its IUPAC name is N-[[3-[4-(4-ethylsulfonylpiperazin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide.
| Compound Name | N-[[3-[4-(4-ethylsulfonylpiperazin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide |
|---|---|
| PubChem CID | 22140975 |
| Molecular Formula | C19H26F2N4O4S2 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[[3-[4-(4-ethylsulfonylpiperazin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide |
| SMILES | CCC(=S)NCC1CN(c2cc(F)c(N3CCN(S(=O)(=O)CC)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H26F2N4O4S2/c1-3-17(30)22-11-14-12-25(19(26)29-14)13-9-15(20)18(16(21)10-13)23-5-7-24(8-6-23)31(27,28)4-2/h9-10,14H,3-8,11-12H2,1-2H3,(H,22,30) |
| InChIKey | WOPOQFUBFKHOGO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|