C17H20F2N4O4S — CID 18713317
O-methyl N-[[(5S)-3-[3,5-difluoro-4-(4-formylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 18713317) has the molecular formula C17H20F2N4O4S and a molecular weight of 414.43 g/mol. Its IUPAC name is O-methyl N-[[(5S)-3-[3,5-difluoro-4-(4-formylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[(5S)-3-[3,5-difluoro-4-(4-formylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 18713317 |
| Molecular Formula | C17H20F2N4O4S |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | O-methyl N-[[(5S)-3-[3,5-difluoro-4-(4-formylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | COC(=S)NC[C@H]1CN(c2cc(F)c(N3CCN(C=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H20F2N4O4S/c1-26-16(28)20-8-12-9-23(17(25)27-12)11-6-13(18)15(14(19)7-11)22-4-2-21(10-24)3-5-22/h6-7,10,12H,2-5,8-9H2,1H3,(H,20,28)/t12-/m0/s1 |
| InChIKey | ZCEORJAAGRYLOH-LBPRGKRZSA-N |
| XLogP | 1.09 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|