C15H21FN5O3S+ — CID 143963421
2-aminoethyl-(aminomethylidene)-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]azanium (PubChem CID 143963421) has the molecular formula C15H21FN5O3S+ and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-aminoethyl-(aminomethylidene)-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]azanium.
| Compound Name | 2-aminoethyl-(aminomethylidene)-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]azanium |
|---|---|
| PubChem CID | 143963421 |
| Molecular Formula | C15H21FN5O3S+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-aminoethyl-(aminomethylidene)-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]azanium |
| SMILES | COC(=S)NC[C@H]1CN(c2ccc(/[N+](=C/N)CCN)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H20FN5O3S/c1-23-14(25)19-7-11-8-21(15(22)24-11)10-2-3-13(12(16)6-10)20(9-18)5-4-17/h2-3,6,9,11,18H,4-5,7-8,17H2,1H3,(H,19,25)/p+1/t11-/m0/s1 |
| InChIKey | VKMVKNYNPHBYIA-NSHDSACASA-O |
| XLogP | 0.26 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|