C16H21FN4O3S — CID 139799574
1-[[(5S)-3-[3-fluoro-4-(3-methoxyazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea (PubChem CID 139799574) has the molecular formula C16H21FN4O3S and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-[[(5S)-3-[3-fluoro-4-(3-methoxyazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea.
| Compound Name | 1-[[(5S)-3-[3-fluoro-4-(3-methoxyazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea |
|---|---|
| PubChem CID | 139799574 |
| Molecular Formula | C16H21FN4O3S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-[[(5S)-3-[3-fluoro-4-(3-methoxyazetidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylthiourea |
| SMILES | CNC(=S)NC[C@H]1CN(c2ccc(N3CC(OC)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H21FN4O3S/c1-18-15(25)19-6-11-9-21(16(22)24-11)10-3-4-14(13(17)5-10)20-7-12(8-20)23-2/h3-5,11-12H,6-9H2,1-2H3,(H2,18,19,25)/t11-/m0/s1 |
| InChIKey | NYFKNUYGNZRMQC-NSHDSACASA-N |
| XLogP | 1.08 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|