C14H17FN2O4 — CID 70196444
3-[3-fluoro-4-(3-methoxyazetidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 70196444) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 3-[3-fluoro-4-(3-methoxyazetidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-fluoro-4-(3-methoxyazetidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70196444 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[3-fluoro-4-(3-methoxyazetidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | COC1CN(c2ccc(N3CC(CO)OC3=O)cc2F)C1 |
| InChI | InChI=1S/C14H17FN2O4/c1-20-10-5-16(6-10)13-3-2-9(4-12(13)15)17-7-11(8-18)21-14(17)19/h2-4,10-11,18H,5-8H2,1H3 |
| InChIKey | JULIKVURNBQYAP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|