C11H15BFNO5 — CID 145042333
[2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]boronic acid;methane (PubChem CID 145042333) has the molecular formula C11H15BFNO5 and a molecular weight of 271.05 g/mol. Its IUPAC name is [2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]boronic acid;methane.
| Compound Name | [2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]boronic acid;methane |
|---|---|
| PubChem CID | 145042333 |
| Molecular Formula | C11H15BFNO5 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]boronic acid;methane |
| SMILES | C.O=C1OC(CO)CN1c1ccc(B(O)O)c(F)c1 |
| InChI | InChI=1S/C10H11BFNO5.CH4/c12-9-3-6(1-2-8(9)11(16)17)13-4-7(5-14)18-10(13)15;/h1-3,7,14,16-17H,4-5H2;1H4 |
| InChIKey | BETNVQGFDZHGPM-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|