C14H13F2N5O3S — CID 86297901
[3-[3,5-difluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea (PubChem CID 86297901) has the molecular formula C14H13F2N5O3S and a molecular weight of 369.35 g/mol. Its IUPAC name is [3-[3,5-difluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea.
| Compound Name | [3-[3,5-difluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
|---|---|
| PubChem CID | 86297901 |
| Molecular Formula | C14H13F2N5O3S |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | [3-[3,5-difluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylthiourea |
| SMILES | Cc1noc(-c2c(F)cc(N3CC(CNC(N)=S)OC3=O)cc2F)n1 |
| InChI | InChI=1S/C14H13F2N5O3S/c1-6-19-12(24-20-6)11-9(15)2-7(3-10(11)16)21-5-8(23-14(21)22)4-18-13(17)25/h2-3,8H,4-5H2,1H3,(H3,17,18,25) |
| InChIKey | IFJIBINAFKQOBY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|