C15H16FN3O4S — CID 20616698
N-[[3-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanesulfonamide (PubChem CID 20616698) has the molecular formula C15H16FN3O4S and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 20616698 |
| Molecular Formula | C15H16FN3O4S |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[[3-[3-fluoro-4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanesulfonamide |
| SMILES | [C-]#[N+]C1(c2ccc(N3CC(CNS(C)(=O)=O)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C15H16FN3O4S/c1-17-15(5-6-15)12-4-3-10(7-13(12)16)19-9-11(23-14(19)20)8-18-24(2,21)22/h3-4,7,11,18H,5-6,8-9H2,2H3 |
| InChIKey | WCMPZBGDKAVLRL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|