C15H15N3O3 — CID 59120577
N-[[(5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide (PubChem CID 59120577) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is N-[[(5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide.
| Compound Name | N-[[(5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 59120577 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-[[(5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]formamide |
| SMILES | [C-]#[N+]C1(c2ccc(N3C[C@H](CNC=O)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C15H15N3O3/c1-16-15(6-7-15)11-2-4-12(5-3-11)18-9-13(8-17-10-19)21-14(18)20/h2-5,10,13H,6-9H2,(H,17,19)/t13-/m0/s1 |
| InChIKey | BOWHTXUQFPZTAP-ZDUSSCGKSA-N |
| XLogP | 1.67 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|