C17H15N5O4 — CID 59120602
1-[[(5R)-3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4-carboxylic acid (PubChem CID 59120602) has the molecular formula C17H15N5O4 and a molecular weight of 353.34 g/mol. Its IUPAC name is 1-[[(5R)-3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4-carboxylic acid.
| Compound Name | 1-[[(5R)-3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 59120602 |
| Molecular Formula | C17H15N5O4 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 1-[[(5R)-3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4-carboxylic acid |
| SMILES | [C-]#[N+]C1(c2ccc(N3C[C@H](Cn4cc(C(=O)O)nn4)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H15N5O4/c1-18-17(6-7-17)11-2-4-12(5-3-11)22-9-13(26-16(22)25)8-21-10-14(15(23)24)19-20-21/h2-5,10,13H,6-9H2,(H,23,24)/t13-/m0/s1 |
| InChIKey | FNGPBLYNAPRKAN-ZDUSSCGKSA-N |
| XLogP | 1.91 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|