C17H16N6O3 — CID 91273822
1-[4-[(5R)-5-[[4-(hydroxyiminomethyl)triazol-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclopropane-1-carbonitrile (PubChem CID 91273822) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is 1-[4-[(5R)-5-[[4-(hydroxyiminomethyl)triazol-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[(5R)-5-[[4-(hydroxyiminomethyl)triazol-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 91273822 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-[4-[(5R)-5-[[4-(hydroxyiminomethyl)triazol-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2ccc(N3C[C@H](Cn4cc(C=NO)nn4)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H16N6O3/c18-11-17(5-6-17)12-1-3-14(4-2-12)23-10-15(26-16(23)24)9-22-8-13(7-19-25)20-21-22/h1-4,7-8,15,25H,5-6,9-10H2/t15-/m0/s1 |
| InChIKey | MPTRTYKAMRWASA-HNNXBMFYSA-N |
| XLogP | 1.67 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|