C17H16N6O3 — CID 173218589
1-[4-[(5R)-5-[[5-(hydroxyiminomethyl)-2H-triazol-4-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclopropane-1-carbonitrile (PubChem CID 173218589) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is 1-[4-[(5R)-5-[[5-(hydroxyiminomethyl)-2H-triazol-4-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[(5R)-5-[[5-(hydroxyiminomethyl)-2H-triazol-4-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 173218589 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-[4-[(5R)-5-[[5-(hydroxyiminomethyl)-2H-triazol-4-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2ccc(N3C[C@@H](Cc4n[nH]nc4C=NO)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H16N6O3/c18-10-17(5-6-17)11-1-3-12(4-2-11)23-9-13(26-16(23)24)7-14-15(8-19-25)21-22-20-14/h1-4,8,13,25H,5-7,9H2,(H,20,21,22)/t13-/m1/s1 |
| InChIKey | XNOIWPHRODESJR-CYBMUJFWSA-N |
| XLogP | 1.74 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|